C20H20F2N2O4S — CID 2098198
[2-(2,4-difluoroanilino)-2-oxoethyl] (2S)-2-benzamido-4-methylsulfanylbutanoate (PubChem CID 2098198) has the molecular formula C20H20F2N2O4S and a molecular weight of 422.45 g/mol. Its IUPAC name is [2-(2,4-difluoroanilino)-2-oxoethyl] (2S)-2-benzamido-4-methylsulfanylbutanoate.
| Compound Name | [2-(2,4-difluoroanilino)-2-oxoethyl] (2S)-2-benzamido-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 2098198 |
| Molecular Formula | C20H20F2N2O4S |
| Molecular Weight | 422.45 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | [2-(2,4-difluoroanilino)-2-oxoethyl] (2S)-2-benzamido-4-methylsulfanylbutanoate |
| SMILES | CSCC[C@H](NC(=O)c1ccccc1)C(=O)OCC(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C20H20F2N2O4S/c1-29-10-9-17(24-19(26)13-5-3-2-4-6-13)20(27)28-12-18(25)23-16-8-7-14(21)11-15(16)22/h2-8,11,17H,9-10,12H2,1H3,(H,23,25)(H,24,26)/t17-/m0/s1 |
| InChIKey | JWRAFKKTSICKAI-KRWDZBQOSA-N |
| XLogP | 3.00 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.45 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |