C14H21NO4S2 — CID 3288090
propan-2-yl 2-[(4-methoxythiophene-3-carbonyl)amino]-4-methylsulfanylbutanoate (PubChem CID 3288090) has the molecular formula C14H21NO4S2 and a molecular weight of 331.46 g/mol. Its IUPAC name is propan-2-yl 2-[(4-methoxythiophene-3-carbonyl)amino]-4-methylsulfanylbutanoate.
| Compound Name | propan-2-yl 2-[(4-methoxythiophene-3-carbonyl)amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 3288090 |
| Molecular Formula | C14H21NO4S2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | propan-2-yl 2-[(4-methoxythiophene-3-carbonyl)amino]-4-methylsulfanylbutanoate |
| SMILES | COc1cscc1C(=O)NC(CCSC)C(=O)OC(C)C |
| InChI | InChI=1S/C14H21NO4S2/c1-9(2)19-14(17)11(5-6-20-4)15-13(16)10-7-21-8-12(10)18-3/h7-9,11H,5-6H2,1-4H3,(H,15,16) |
| InChIKey | VFLUMQYABQAVDI-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |