C13H18N2O4S — CID 107208004
(2R)-2-[(4-amino-2-methoxybenzoyl)amino]-4-methylsulfanylbutanoic acid (PubChem CID 107208004) has the molecular formula C13H18N2O4S and a molecular weight of 298.36 g/mol. Its IUPAC name is (2R)-2-[(4-amino-2-methoxybenzoyl)amino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2R)-2-[(4-amino-2-methoxybenzoyl)amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 107208004 |
| Molecular Formula | C13H18N2O4S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | (2R)-2-[(4-amino-2-methoxybenzoyl)amino]-4-methylsulfanylbutanoic acid |
| SMILES | COc1cc(N)ccc1C(=O)N[C@H](CCSC)C(=O)O |
| InChI | InChI=1S/C13H18N2O4S/c1-19-11-7-8(14)3-4-9(11)12(16)15-10(13(17)18)5-6-20-2/h3-4,7,10H,5-6,14H2,1-2H3,(H,15,16)(H,17,18)/t10-/m1/s1 |
| InChIKey | IXVXVBUAGKLJDL-SNVBAGLBSA-N |
| XLogP | 1.21 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|