C15H19NO5S — CID 140569334
2-[(2-acetyl-4-methoxybenzoyl)amino]-4-methylsulfanylbutanoic acid (PubChem CID 140569334) has the molecular formula C15H19NO5S and a molecular weight of 325.39 g/mol. Its IUPAC name is 2-[(2-acetyl-4-methoxybenzoyl)amino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[(2-acetyl-4-methoxybenzoyl)amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 140569334 |
| Molecular Formula | C15H19NO5S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 2-[(2-acetyl-4-methoxybenzoyl)amino]-4-methylsulfanylbutanoic acid |
| SMILES | COc1ccc(C(=O)NC(CCSC)C(=O)O)c(C(C)=O)c1 |
| InChI | InChI=1S/C15H19NO5S/c1-9(17)12-8-10(21-2)4-5-11(12)14(18)16-13(15(19)20)6-7-22-3/h4-5,8,13H,6-7H2,1-3H3,(H,16,18)(H,19,20) |
| InChIKey | DLSOLBPJRGBCIG-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |