C10H21NO4S — CID 146671813
propan-2-yl (2S)-2-[[hydroxy(methoxy)methyl]amino]-4-methylsulfanylbutanoate (PubChem CID 146671813) has the molecular formula C10H21NO4S and a molecular weight of 251.35 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[hydroxy(methoxy)methyl]amino]-4-methylsulfanylbutanoate.
| Compound Name | propan-2-yl (2S)-2-[[hydroxy(methoxy)methyl]amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 146671813 |
| Molecular Formula | C10H21NO4S |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | propan-2-yl (2S)-2-[[hydroxy(methoxy)methyl]amino]-4-methylsulfanylbutanoate |
| SMILES | COC(O)N[C@@H](CCSC)C(=O)OC(C)C |
| InChI | InChI=1S/C10H21NO4S/c1-7(2)15-9(12)8(5-6-16-4)11-10(13)14-3/h7-8,10-11,13H,5-6H2,1-4H3/t8-,10?/m0/s1 |
| InChIKey | YXJINOKSGFFJLX-PEHGTWAWSA-N |
| XLogP | 0.57 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|