C16H30N2O6S — CID 59050283
propan-2-yl (2S)-2-[[(2R)-2-[(1S)-1-hydroxy-2-(hydroxyamino)-2-oxoethyl]-4-methylpentanoyl]amino]-4-methylsulfanylbutanoate (PubChem CID 59050283) has the molecular formula C16H30N2O6S and a molecular weight of 378.49 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[(2R)-2-[(1S)-1-hydroxy-2-(hydroxyamino)-2-oxoethyl]-4-methylpentanoyl]amino]-4-methylsulfanylbutanoate.
| Compound Name | propan-2-yl (2S)-2-[[(2R)-2-[(1S)-1-hydroxy-2-(hydroxyamino)-2-oxoethyl]-4-methylpentanoyl]amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 59050283 |
| Molecular Formula | C16H30N2O6S |
| Molecular Weight | 378.49 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | propan-2-yl (2S)-2-[[(2R)-2-[(1S)-1-hydroxy-2-(hydroxyamino)-2-oxoethyl]-4-methylpentanoyl]amino]-4-methylsulfanylbutanoate |
| SMILES | CSCC[C@H](NC(=O)[C@H](CC(C)C)[C@H](O)C(=O)NO)C(=O)OC(C)C |
| InChI | InChI=1S/C16H30N2O6S/c1-9(2)8-11(13(19)15(21)18-23)14(20)17-12(6-7-25-5)16(22)24-10(3)4/h9-13,19,23H,6-8H2,1-5H3,(H,17,20)(H,18,21)/t11-,12+,13+/m1/s1 |
| InChIKey | GENZPILBIVBSGX-AGIUHOORSA-N |
| XLogP | 0.70 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.49 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|