C7H15NO2S — CID 23436119
methyl 2-(methylamino)-4-methylsulfanylbutanoate (PubChem CID 23436119) has the molecular formula C7H15NO2S and a molecular weight of 177.27 g/mol. Its IUPAC name is methyl 2-(methylamino)-4-methylsulfanylbutanoate.
| Compound Name | methyl 2-(methylamino)-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 23436119 |
| Molecular Formula | C7H15NO2S |
| Molecular Weight | 177.27 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | methyl 2-(methylamino)-4-methylsulfanylbutanoate |
| SMILES | CNC(CCSC)C(=O)OC |
| InChI | InChI=1S/C7H15NO2S/c1-8-6(4-5-11-3)7(9)10-2/h6,8H,4-5H2,1-3H3 |
| InChIKey | CBAKLEVLBHBVOC-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.27 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |