methyl 2-(methylamino)-4-methylsulfanylbutanoate

C7H15NO2S — CID 23436119

IUPACmethyl 2-(methylamino)-4-methylsulfanylbutanoate
SMILESCNC(CCSC)C(=O)OC
InChIInChI=1S/C7H15NO2S/c1-8-6(4-5-11-3)7(9)10-2/h6,8H,4-5H2,1-3H3
InChIKeyCBAKLEVLBHBVOC-UHFFFAOYSA-N
MW177.27 g/mol
LogP0.50
Rot. Bonds5

About methyl 2-(methylamino)-4-methylsulfanylbutanoate

methyl 2-(methylamino)-4-methylsulfanylbutanoate (PubChem CID 23436119) has the molecular formula C7H15NO2S and a molecular weight of 177.27 g/mol. Its IUPAC name is methyl 2-(methylamino)-4-methylsulfanylbutanoate.

Molecular Properties

Compound Namemethyl 2-(methylamino)-4-methylsulfanylbutanoate
PubChem CID23436119
Molecular FormulaC7H15NO2S
Molecular Weight177.27 g/mol
Exact Mass177.08
IUPAC Namemethyl 2-(methylamino)-4-methylsulfanylbutanoate
SMILESCNC(CCSC)C(=O)OC
InChIInChI=1S/C7H15NO2S/c1-8-6(4-5-11-3)7(9)10-2/h6,8H,4-5H2,1-3H3
InChIKeyCBAKLEVLBHBVOC-UHFFFAOYSA-N
XLogP0.50
TPSA38.33 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500177.27
LogP ≤ 50.50
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 2-(methylamino)-4-methylsulfanylbutanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(methylamino)-4-methylsulfanylbutanoate?
The IUPAC name of methyl 2-(methylamino)-4-methylsulfanylbutanoate (CID 23436119) is methyl 2-(methylamino)-4-methylsulfanylbutanoate.
What is the SMILES notation for methyl 2-(methylamino)-4-methylsulfanylbutanoate?
The canonical SMILES for methyl 2-(methylamino)-4-methylsulfanylbutanoate is CNC(CCSC)C(=O)OC.
What is the InChIKey of methyl 2-(methylamino)-4-methylsulfanylbutanoate?
The InChIKey is CBAKLEVLBHBVOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO2S/c1-8-6(4-5-11-3)7(9)10-2/h6,8H,4-5H2,1-3H3.
What are the key properties of methyl 2-(methylamino)-4-methylsulfanylbutanoate?
methyl 2-(methylamino)-4-methylsulfanylbutanoate has a molecular weight of 177.27 g/mol, XLogP of 0.50, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(methylamino)-4-methylsulfanylbutanoate is sourced from PubChem (CID 23436119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).