C6H13Cl2NO2PtS — CID 138397899
methyl (2S)-2-amino-4-methylsulfanylbutanoate;platinum(2+);dichloride (PubChem CID 138397899) has the molecular formula C6H13Cl2NO2PtS and a molecular weight of 429.23 g/mol. Its IUPAC name is methyl (2S)-2-amino-4-methylsulfanylbutanoate;platinum(2+);dichloride.
| Compound Name | methyl (2S)-2-amino-4-methylsulfanylbutanoate;platinum(2+);dichloride |
|---|---|
| PubChem CID | 138397899 |
| Molecular Formula | C6H13Cl2NO2PtS |
| Molecular Weight | 429.23 g/mol |
| Exact Mass | 427.97 |
| IUPAC Name | methyl (2S)-2-amino-4-methylsulfanylbutanoate;platinum(2+);dichloride |
| SMILES | COC(=O)[C@@H](N)CCSC.[Cl-].[Cl-].[Pt+2] |
| InChI | InChI=1S/C6H13NO2S.2ClH.Pt/c1-9-6(8)5(7)3-4-10-2;;;/h5H,3-4,7H2,1-2H3;2*1H;/q;;;+2/p-2/t5-;;;/m0.../s1 |
| InChIKey | RAIUUDGYMMXSCG-BHRFRFAJSA-L |
| XLogP | -5.75 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.23 |
| LogP ≤ 5 | -5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |