About amino (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride
amino (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride (PubChem CID 141292126) has the molecular formula C5H13ClN2O2S
and a molecular weight of 200.69 g/mol. Its IUPAC name is amino (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride.
Molecular Properties
| Compound Name | amino (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride |
| PubChem CID | 141292126 |
| Molecular Formula | C5H13ClN2O2S |
| Molecular Weight | 200.69 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | amino (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride |
| SMILES | CSCC[C@H](N)C(=O)ON.Cl |
| InChI | InChI=1S/C5H12N2O2S.ClH/c1-10-3-2-4(6)5(8)9-7;/h4H,2-3,6-7H2,1H3;1H/t4-;/m0./s1 |
| InChIKey | NIIWIOCUJJWNLC-WCCKRBBISA-N |
| XLogP | -0.09 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.69 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze amino (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of amino (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride?
The IUPAC name of amino (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride (CID 141292126) is amino (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride.
What is the SMILES notation for amino (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride?
The canonical SMILES for amino (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride is CSCC[C@H](N)C(=O)ON.Cl.
What is the InChIKey of amino (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride?
The InChIKey is NIIWIOCUJJWNLC-WCCKRBBISA-N. The full InChI is InChI=1S/C5H12N2O2S.ClH/c1-10-3-2-4(6)5(8)9-7;/h4H,2-3,6-7H2,1H3;1H/t4-;/m0./s1.
What are the key properties of amino (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride?
amino (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride has a molecular weight of 200.69 g/mol, XLogP of -0.09, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for amino (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride is sourced from PubChem (CID 141292126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).