About butyl (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride
butyl (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride (PubChem CID 139951109) has the molecular formula C9H20ClNO2S
and a molecular weight of 241.78 g/mol. Its IUPAC name is butyl (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride.
Molecular Properties
| Compound Name | butyl (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride |
| PubChem CID | 139951109 |
| Molecular Formula | C9H20ClNO2S |
| Molecular Weight | 241.78 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | butyl (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride |
| SMILES | CCCCOC(=O)[C@@H](N)CCSC.Cl |
| InChI | InChI=1S/C9H19NO2S.ClH/c1-3-4-6-12-9(11)8(10)5-7-13-2;/h8H,3-7,10H2,1-2H3;1H/t8-;/m0./s1 |
| InChIKey | BIDPHTNMUXUECE-QRPNPIFTSA-N |
| XLogP | 1.83 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.78 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride?
The IUPAC name of butyl (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride (CID 139951109) is butyl (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride.
What is the SMILES notation for butyl (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride?
The canonical SMILES for butyl (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride is CCCCOC(=O)[C@@H](N)CCSC.Cl.
What is the InChIKey of butyl (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride?
The InChIKey is BIDPHTNMUXUECE-QRPNPIFTSA-N. The full InChI is InChI=1S/C9H19NO2S.ClH/c1-3-4-6-12-9(11)8(10)5-7-13-2;/h8H,3-7,10H2,1-2H3;1H/t8-;/m0./s1.
What are the key properties of butyl (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride?
butyl (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride has a molecular weight of 241.78 g/mol, XLogP of 1.83, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butyl (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride is sourced from PubChem (CID 139951109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).