About 2-(diethylamino)ethyl (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride
2-(diethylamino)ethyl (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride (PubChem CID 175942177) has the molecular formula C11H25ClN2O2S
and a molecular weight of 284.85 g/mol. Its IUPAC name is 2-(diethylamino)ethyl (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride.
Molecular Properties
| Compound Name | 2-(diethylamino)ethyl (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride |
| PubChem CID | 175942177 |
| Molecular Formula | C11H25ClN2O2S |
| Molecular Weight | 284.85 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 2-(diethylamino)ethyl (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride |
| SMILES | CCN(CC)CCOC(=O)[C@@H](N)CCSC.Cl |
| InChI | InChI=1S/C11H24N2O2S.ClH/c1-4-13(5-2)7-8-15-11(14)10(12)6-9-16-3;/h10H,4-9,12H2,1-3H3;1H/t10-;/m0./s1 |
| InChIKey | SVAIQHJPDMBISF-PPHPATTJSA-N |
| XLogP | 1.37 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.85 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(diethylamino)ethyl (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethylamino)ethyl (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride?
The IUPAC name of 2-(diethylamino)ethyl (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride (CID 175942177) is 2-(diethylamino)ethyl (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride.
What is the SMILES notation for 2-(diethylamino)ethyl (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride?
The canonical SMILES for 2-(diethylamino)ethyl (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride is CCN(CC)CCOC(=O)[C@@H](N)CCSC.Cl.
What is the InChIKey of 2-(diethylamino)ethyl (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride?
The InChIKey is SVAIQHJPDMBISF-PPHPATTJSA-N. The full InChI is InChI=1S/C11H24N2O2S.ClH/c1-4-13(5-2)7-8-15-11(14)10(12)6-9-16-3;/h10H,4-9,12H2,1-3H3;1H/t10-;/m0./s1.
What are the key properties of 2-(diethylamino)ethyl (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride?
2-(diethylamino)ethyl (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride has a molecular weight of 284.85 g/mol, XLogP of 1.37, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethylamino)ethyl (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride is sourced from PubChem (CID 175942177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).