C11H25N3OS — CID 61148645
(2S)-2-amino-N-[2-(diethylamino)ethyl]-4-methylsulfanylbutanamide (PubChem CID 61148645) has the molecular formula C11H25N3OS and a molecular weight of 247.41 g/mol. Its IUPAC name is (2S)-2-amino-N-[2-(diethylamino)ethyl]-4-methylsulfanylbutanamide.
| Compound Name | (2S)-2-amino-N-[2-(diethylamino)ethyl]-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 61148645 |
| Molecular Formula | C11H25N3OS |
| Molecular Weight | 247.41 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | (2S)-2-amino-N-[2-(diethylamino)ethyl]-4-methylsulfanylbutanamide |
| SMILES | CCN(CC)CCNC(=O)[C@@H](N)CCSC |
| InChI | InChI=1S/C11H25N3OS/c1-4-14(5-2)8-7-13-11(15)10(12)6-9-16-3/h10H,4-9,12H2,1-3H3,(H,13,15)/t10-/m0/s1 |
| InChIKey | PYKVKJVBHBXXSD-JTQLQIEISA-N |
| XLogP | 0.52 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.41 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |