C10H21N3O2S — CID 104909009
(2R)-2-amino-N-[3-(ethylamino)-3-oxopropyl]-4-methylsulfanylbutanamide (PubChem CID 104909009) has the molecular formula C10H21N3O2S and a molecular weight of 247.36 g/mol. Its IUPAC name is (2R)-2-amino-N-[3-(ethylamino)-3-oxopropyl]-4-methylsulfanylbutanamide.
| Compound Name | (2R)-2-amino-N-[3-(ethylamino)-3-oxopropyl]-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 104909009 |
| Molecular Formula | C10H21N3O2S |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | (2R)-2-amino-N-[3-(ethylamino)-3-oxopropyl]-4-methylsulfanylbutanamide |
| SMILES | CCNC(=O)CCNC(=O)[C@H](N)CCSC |
| InChI | InChI=1S/C10H21N3O2S/c1-3-12-9(14)4-6-13-10(15)8(11)5-7-16-2/h8H,3-7,11H2,1-2H3,(H,12,14)(H,13,15)/t8-/m1/s1 |
| InChIKey | UXIBXOLXYOLMLU-MRVPVSSYSA-N |
| XLogP | -0.29 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |