About tetradecyl (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride
tetradecyl (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride (PubChem CID 139632808) has the molecular formula C19H40ClNO2S
and a molecular weight of 382.05 g/mol. Its IUPAC name is tetradecyl (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride.
Molecular Properties
| Compound Name | tetradecyl (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride |
| PubChem CID | 139632808 |
| Molecular Formula | C19H40ClNO2S |
| Molecular Weight | 382.05 g/mol |
| Exact Mass | 381.25 |
| IUPAC Name | tetradecyl (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride |
| SMILES | CCCCCCCCCCCCCCOC(=O)[C@@H](N)CCSC.Cl |
| InChI | InChI=1S/C19H39NO2S.ClH/c1-3-4-5-6-7-8-9-10-11-12-13-14-16-22-19(21)18(20)15-17-23-2;/h18H,3-17,20H2,1-2H3;1H/t18-;/m0./s1 |
| InChIKey | IRXXFARLNVBMTJ-FERBBOLQSA-N |
| XLogP | 5.73 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.05 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tetradecyl (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetradecyl (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride?
The IUPAC name of tetradecyl (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride (CID 139632808) is tetradecyl (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride.
What is the SMILES notation for tetradecyl (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride?
The canonical SMILES for tetradecyl (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride is CCCCCCCCCCCCCCOC(=O)[C@@H](N)CCSC.Cl.
What is the InChIKey of tetradecyl (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride?
The InChIKey is IRXXFARLNVBMTJ-FERBBOLQSA-N. The full InChI is InChI=1S/C19H39NO2S.ClH/c1-3-4-5-6-7-8-9-10-11-12-13-14-16-22-19(21)18(20)15-17-23-2;/h18H,3-17,20H2,1-2H3;1H/t18-;/m0./s1.
What are the key properties of tetradecyl (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride?
tetradecyl (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride has a molecular weight of 382.05 g/mol, XLogP of 5.73, 17 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tetradecyl (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride is sourced from PubChem (CID 139632808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).