C12H27N3O2 — CID 175942176
2-(diethylamino)ethyl (2S)-2,6-diaminohexanoate (PubChem CID 175942176) has the molecular formula C12H27N3O2 and a molecular weight of 245.37 g/mol. Its IUPAC name is 2-(diethylamino)ethyl (2S)-2,6-diaminohexanoate.
| Compound Name | 2-(diethylamino)ethyl (2S)-2,6-diaminohexanoate |
|---|---|
| PubChem CID | 175942176 |
| Molecular Formula | C12H27N3O2 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.21 |
| IUPAC Name | 2-(diethylamino)ethyl (2S)-2,6-diaminohexanoate |
| SMILES | CCN(CC)CCOC(=O)[C@@H](N)CCCCN |
| InChI | InChI=1S/C12H27N3O2/c1-3-15(4-2)9-10-17-12(16)11(14)7-5-6-8-13/h11H,3-10,13-14H2,1-2H3/t11-/m0/s1 |
| InChIKey | SRNZGYBEOHZSNJ-NSHDSACASA-N |
| XLogP | 0.33 |
| TPSA | 81.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|