C11H24N2O2 — CID 142497422
3-methylbutyl 2,6-diaminohexanoate (PubChem CID 142497422) has the molecular formula C11H24N2O2 and a molecular weight of 216.32 g/mol. Its IUPAC name is 3-methylbutyl 2,6-diaminohexanoate.
| Compound Name | 3-methylbutyl 2,6-diaminohexanoate |
|---|---|
| PubChem CID | 142497422 |
| Molecular Formula | C11H24N2O2 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.18 |
| IUPAC Name | 3-methylbutyl 2,6-diaminohexanoate |
| SMILES | CC(C)CCOC(=O)C(N)CCCCN |
| InChI | InChI=1S/C11H24N2O2/c1-9(2)6-8-15-11(14)10(13)5-3-4-7-12/h9-10H,3-8,12-13H2,1-2H3 |
| InChIKey | PQWBIKGCPXNPLT-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|