C8H17N3O3S — CID 88794349
2,3-diaminopropanoyl (2S)-2-amino-4-methylsulfanylbutanoate (PubChem CID 88794349) has the molecular formula C8H17N3O3S and a molecular weight of 235.31 g/mol. Its IUPAC name is 2,3-diaminopropanoyl (2S)-2-amino-4-methylsulfanylbutanoate.
| Compound Name | 2,3-diaminopropanoyl (2S)-2-amino-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 88794349 |
| Molecular Formula | C8H17N3O3S |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 2,3-diaminopropanoyl (2S)-2-amino-4-methylsulfanylbutanoate |
| SMILES | CSCC[C@H](N)C(=O)OC(=O)C(N)CN |
| InChI | InChI=1S/C8H17N3O3S/c1-15-3-2-5(10)7(12)14-8(13)6(11)4-9/h5-6H,2-4,9-11H2,1H3/t5-,6?/m0/s1 |
| InChIKey | LZPHPUDENJSXKK-ZBHICJROSA-N |
| XLogP | -1.58 |
| TPSA | 121.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|