methyl 4-methylsulfanyl-2-(2,2,2-trifluoroethylamino)butanoate

C8H14F3NO2S — CID 60997986

IUPACmethyl 4-methylsulfanyl-2-(2,2,2-trifluoroethylamino)butanoate
SMILESCOC(=O)C(CCSC)NCC(F)(F)F
InChIInChI=1S/C8H14F3NO2S/c1-14-7(13)6(3-4-15-2)12-5-8(9,10)11/h6,12H,3-5H2,1-2H3
InChIKeyPGQKSRAVRBPOKM-UHFFFAOYSA-N
MW245.27 g/mol
LogP1.43
Rot. Bonds6

About methyl 4-methylsulfanyl-2-(2,2,2-trifluoroethylamino)butanoate

methyl 4-methylsulfanyl-2-(2,2,2-trifluoroethylamino)butanoate (PubChem CID 60997986) has the molecular formula C8H14F3NO2S and a molecular weight of 245.27 g/mol. Its IUPAC name is methyl 4-methylsulfanyl-2-(2,2,2-trifluoroethylamino)butanoate.

Molecular Properties

Compound Namemethyl 4-methylsulfanyl-2-(2,2,2-trifluoroethylamino)butanoate
PubChem CID60997986
Molecular FormulaC8H14F3NO2S
Molecular Weight245.27 g/mol
Exact Mass245.07
IUPAC Namemethyl 4-methylsulfanyl-2-(2,2,2-trifluoroethylamino)butanoate
SMILESCOC(=O)C(CCSC)NCC(F)(F)F
InChIInChI=1S/C8H14F3NO2S/c1-14-7(13)6(3-4-15-2)12-5-8(9,10)11/h6,12H,3-5H2,1-2H3
InChIKeyPGQKSRAVRBPOKM-UHFFFAOYSA-N
XLogP1.43
TPSA38.33 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500245.27
LogP ≤ 51.43
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 4-methylsulfanyl-2-(2,2,2-trifluoroethylamino)butanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-methylsulfanyl-2-(2,2,2-trifluoroethylamino)butanoate?
The IUPAC name of methyl 4-methylsulfanyl-2-(2,2,2-trifluoroethylamino)butanoate (CID 60997986) is methyl 4-methylsulfanyl-2-(2,2,2-trifluoroethylamino)butanoate.
What is the SMILES notation for methyl 4-methylsulfanyl-2-(2,2,2-trifluoroethylamino)butanoate?
The canonical SMILES for methyl 4-methylsulfanyl-2-(2,2,2-trifluoroethylamino)butanoate is COC(=O)C(CCSC)NCC(F)(F)F.
What is the InChIKey of methyl 4-methylsulfanyl-2-(2,2,2-trifluoroethylamino)butanoate?
The InChIKey is PGQKSRAVRBPOKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14F3NO2S/c1-14-7(13)6(3-4-15-2)12-5-8(9,10)11/h6,12H,3-5H2,1-2H3.
What are the key properties of methyl 4-methylsulfanyl-2-(2,2,2-trifluoroethylamino)butanoate?
methyl 4-methylsulfanyl-2-(2,2,2-trifluoroethylamino)butanoate has a molecular weight of 245.27 g/mol, XLogP of 1.43, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-methylsulfanyl-2-(2,2,2-trifluoroethylamino)butanoate is sourced from PubChem (CID 60997986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).