C16H16ClNO2S — CID 7433160
trans-(2-chloro-7-methylsulfanylquinolin-3-yl)methyl (1R,2R)-2-methylcyclopropane-1-carboxylate (PubChem CID 7433160) has the molecular formula C16H16ClNO2S and a molecular weight of 321.83 g/mol. Its IUPAC name is trans-(2-chloro-7-methylsulfanylquinolin-3-yl)methyl (1R,2R)-2-methylcyclopropane-1-carboxylate.
| Compound Name | trans-(2-chloro-7-methylsulfanylquinolin-3-yl)methyl (1R,2R)-2-methylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 7433160 |
| Molecular Formula | C16H16ClNO2S |
| Molecular Weight | 321.83 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | trans-(2-chloro-7-methylsulfanylquinolin-3-yl)methyl (1R,2R)-2-methylcyclopropane-1-carboxylate |
| SMILES | CSc1ccc2cc(COC(=O)[C@@H]3C[C@H]3C)c(Cl)nc2c1 |
| InChI | InChI=1S/C16H16ClNO2S/c1-9-5-13(9)16(19)20-8-11-6-10-3-4-12(21-2)7-14(10)18-15(11)17/h3-4,6-7,9,13H,5,8H2,1-2H3/t9-,13-/m1/s1 |
| InChIKey | KCJJDNYCTVHSCF-NOZJJQNGSA-N |
| XLogP | 4.31 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.83 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|