C20H20ClN2O2S+ — CID 8748214
1,3-benzodioxol-5-ylmethyl-[(2-chloro-7-methylsulfanylquinolin-3-yl)methyl]-methylazanium (PubChem CID 8748214) has the molecular formula C20H20ClN2O2S+ and a molecular weight of 387.91 g/mol. Its IUPAC name is 1,3-benzodioxol-5-ylmethyl-[(2-chloro-7-methylsulfanylquinolin-3-yl)methyl]-methylazanium.
| Compound Name | 1,3-benzodioxol-5-ylmethyl-[(2-chloro-7-methylsulfanylquinolin-3-yl)methyl]-methylazanium |
|---|---|
| PubChem CID | 8748214 |
| Molecular Formula | C20H20ClN2O2S+ |
| Molecular Weight | 387.91 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | 1,3-benzodioxol-5-ylmethyl-[(2-chloro-7-methylsulfanylquinolin-3-yl)methyl]-methylazanium |
| SMILES | CSc1ccc2cc(C[NH+](C)Cc3ccc4c(c3)OCO4)c(Cl)nc2c1 |
| InChI | InChI=1S/C20H19ClN2O2S/c1-23(10-13-3-6-18-19(7-13)25-12-24-18)11-15-8-14-4-5-16(26-2)9-17(14)22-20(15)21/h3-9H,10-12H2,1-2H3/p+1 |
| InChIKey | PCOLEFAJXZPMSO-UHFFFAOYSA-O |
| XLogP | 3.55 |
| TPSA | 35.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.91 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|