C23H27ClN2O3 — CID 16608746
N-[(2-chloro-7-methoxyquinolin-3-yl)methyl]-N-[(4-ethoxy-3-methoxyphenyl)methyl]ethanamine (PubChem CID 16608746) has the molecular formula C23H27ClN2O3 and a molecular weight of 414.93 g/mol. Its IUPAC name is N-[(2-chloro-7-methoxyquinolin-3-yl)methyl]-N-[(4-ethoxy-3-methoxyphenyl)methyl]ethanamine.
| Compound Name | N-[(2-chloro-7-methoxyquinolin-3-yl)methyl]-N-[(4-ethoxy-3-methoxyphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 16608746 |
| Molecular Formula | C23H27ClN2O3 |
| Molecular Weight | 414.93 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | N-[(2-chloro-7-methoxyquinolin-3-yl)methyl]-N-[(4-ethoxy-3-methoxyphenyl)methyl]ethanamine |
| SMILES | CCOc1ccc(CN(CC)Cc2cc3ccc(OC)cc3nc2Cl)cc1OC |
| InChI | InChI=1S/C23H27ClN2O3/c1-5-26(14-16-7-10-21(29-6-2)22(11-16)28-4)15-18-12-17-8-9-19(27-3)13-20(17)25-23(18)24/h7-13H,5-6,14-15H2,1-4H3 |
| InChIKey | QDTDMYHKMXOZSQ-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 43.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.93 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|