C23H25ClN2O3 — CID 26201479
2-chloro-3-[[(2S)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]methyl]-7-methoxyquinoline (PubChem CID 26201479) has the molecular formula C23H25ClN2O3 and a molecular weight of 412.92 g/mol. Its IUPAC name is 2-chloro-3-[[(2S)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]methyl]-7-methoxyquinoline.
| Compound Name | 2-chloro-3-[[(2S)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]methyl]-7-methoxyquinoline |
|---|---|
| PubChem CID | 26201479 |
| Molecular Formula | C23H25ClN2O3 |
| Molecular Weight | 412.92 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 2-chloro-3-[[(2S)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]methyl]-7-methoxyquinoline |
| SMILES | COc1ccc(OC)c([C@@H]2CCCN2Cc2cc3ccc(OC)cc3nc2Cl)c1 |
| InChI | InChI=1S/C23H25ClN2O3/c1-27-17-8-9-22(29-3)19(12-17)21-5-4-10-26(21)14-16-11-15-6-7-18(28-2)13-20(15)25-23(16)24/h6-9,11-13,21H,4-5,10,14H2,1-3H3/t21-/m0/s1 |
| InChIKey | PUHDXFXVFFVIDC-NRFANRHFSA-N |
| XLogP | 5.25 |
| TPSA | 43.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.92 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|