C19H23ClN2O3 — CID 26201452
ethyl (3R)-1-[(2-chloro-7-methoxyquinolin-3-yl)methyl]piperidine-3-carboxylate (PubChem CID 26201452) has the molecular formula C19H23ClN2O3 and a molecular weight of 362.86 g/mol. Its IUPAC name is ethyl (3R)-1-[(2-chloro-7-methoxyquinolin-3-yl)methyl]piperidine-3-carboxylate.
| Compound Name | ethyl (3R)-1-[(2-chloro-7-methoxyquinolin-3-yl)methyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 26201452 |
| Molecular Formula | C19H23ClN2O3 |
| Molecular Weight | 362.86 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | ethyl (3R)-1-[(2-chloro-7-methoxyquinolin-3-yl)methyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCN(Cc2cc3ccc(OC)cc3nc2Cl)C1 |
| InChI | InChI=1S/C19H23ClN2O3/c1-3-25-19(23)14-5-4-8-22(11-14)12-15-9-13-6-7-16(24-2)10-17(13)21-18(15)20/h6-7,9-10,14H,3-5,8,11-12H2,1-2H3/t14-/m1/s1 |
| InChIKey | PKCCOGXLIFLDFD-CQSZACIVSA-N |
| XLogP | 3.67 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.86 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|