C22H23ClN2O2 — CID 70732351
[(2S)-1-[[2-(4-chlorophenyl)-7-methoxyquinolin-3-yl]methyl]pyrrolidin-2-yl]methanol (PubChem CID 70732351) has the molecular formula C22H23ClN2O2 and a molecular weight of 382.89 g/mol. Its IUPAC name is [(2S)-1-[[2-(4-chlorophenyl)-7-methoxyquinolin-3-yl]methyl]pyrrolidin-2-yl]methanol.
| Compound Name | [(2S)-1-[[2-(4-chlorophenyl)-7-methoxyquinolin-3-yl]methyl]pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 70732351 |
| Molecular Formula | C22H23ClN2O2 |
| Molecular Weight | 382.89 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | [(2S)-1-[[2-(4-chlorophenyl)-7-methoxyquinolin-3-yl]methyl]pyrrolidin-2-yl]methanol |
| SMILES | COc1ccc2cc(CN3CCC[C@H]3CO)c(-c3ccc(Cl)cc3)nc2c1 |
| InChI | InChI=1S/C22H23ClN2O2/c1-27-20-9-6-16-11-17(13-25-10-2-3-19(25)14-26)22(24-21(16)12-20)15-4-7-18(23)8-5-15/h4-9,11-12,19,26H,2-3,10,13-14H2,1H3/t19-/m0/s1 |
| InChIKey | VYODULNMRDNEGF-IBGZPJMESA-N |
| XLogP | 4.52 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.89 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |