C20H21NO3 — CID 16638258
2-[2-(3,4-dimethoxyphenyl)ethyl]-7-methoxyquinoline (PubChem CID 16638258) has the molecular formula C20H21NO3 and a molecular weight of 323.39 g/mol. Its IUPAC name is 2-[2-(3,4-dimethoxyphenyl)ethyl]-7-methoxyquinoline.
| Compound Name | 2-[2-(3,4-dimethoxyphenyl)ethyl]-7-methoxyquinoline |
|---|---|
| PubChem CID | 16638258 |
| Molecular Formula | C20H21NO3 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 2-[2-(3,4-dimethoxyphenyl)ethyl]-7-methoxyquinoline |
| SMILES | COc1ccc2ccc(CCc3ccc(OC)c(OC)c3)nc2c1 |
| InChI | InChI=1S/C20H21NO3/c1-22-17-10-7-15-6-9-16(21-18(15)13-17)8-4-14-5-11-19(23-2)20(12-14)24-3/h5-7,9-13H,4,8H2,1-3H3 |
| InChIKey | XGAQBTRHPFHCII-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |