C20H22ClNO3 — CID 16637848
2-[2-(3,4-dimethoxyphenyl)ethyl]-4-methoxyquinoline;hydrochloride (PubChem CID 16637848) has the molecular formula C20H22ClNO3 and a molecular weight of 359.85 g/mol. Its IUPAC name is 2-[2-(3,4-dimethoxyphenyl)ethyl]-4-methoxyquinoline;hydrochloride.
| Compound Name | 2-[2-(3,4-dimethoxyphenyl)ethyl]-4-methoxyquinoline;hydrochloride |
|---|---|
| PubChem CID | 16637848 |
| Molecular Formula | C20H22ClNO3 |
| Molecular Weight | 359.85 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 2-[2-(3,4-dimethoxyphenyl)ethyl]-4-methoxyquinoline;hydrochloride |
| SMILES | COc1ccc(CCc2cc(OC)c3ccccc3n2)cc1OC.Cl |
| InChI | InChI=1S/C20H21NO3.ClH/c1-22-18-11-9-14(12-20(18)24-3)8-10-15-13-19(23-2)16-6-4-5-7-17(16)21-15;/h4-7,9,11-13H,8,10H2,1-3H3;1H |
| InChIKey | LZWOWJFTYQZUEN-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.85 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |