C21H24N2O2 — CID 167837344
N-[(3,4-dimethoxyphenyl)methyl]-N-(quinolin-3-ylmethyl)ethanamine (PubChem CID 167837344) has the molecular formula C21H24N2O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-N-(quinolin-3-ylmethyl)ethanamine.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-N-(quinolin-3-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 167837344 |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-N-(quinolin-3-ylmethyl)ethanamine |
| SMILES | CCN(Cc1ccc(OC)c(OC)c1)Cc1cnc2ccccc2c1 |
| InChI | InChI=1S/C21H24N2O2/c1-4-23(14-16-9-10-20(24-2)21(12-16)25-3)15-17-11-18-7-5-6-8-19(18)22-13-17/h5-13H,4,14-15H2,1-3H3 |
| InChIKey | ISZCZNHBMGRWMH-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |