C18H19ClO5 — CID 7921059
(2-chloro-5-methylphenyl) 2-(3,4,5-trimethoxyphenyl)acetate (PubChem CID 7921059) has the molecular formula C18H19ClO5 and a molecular weight of 350.80 g/mol. Its IUPAC name is (2-chloro-5-methylphenyl) 2-(3,4,5-trimethoxyphenyl)acetate.
| Compound Name | (2-chloro-5-methylphenyl) 2-(3,4,5-trimethoxyphenyl)acetate |
|---|---|
| PubChem CID | 7921059 |
| Molecular Formula | C18H19ClO5 |
| Molecular Weight | 350.80 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | (2-chloro-5-methylphenyl) 2-(3,4,5-trimethoxyphenyl)acetate |
| SMILES | COc1cc(CC(=O)Oc2cc(C)ccc2Cl)cc(OC)c1OC |
| InChI | InChI=1S/C18H19ClO5/c1-11-5-6-13(19)14(7-11)24-17(20)10-12-8-15(21-2)18(23-4)16(9-12)22-3/h5-9H,10H2,1-4H3 |
| InChIKey | FJSHUVZCAMNNHV-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.80 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|