C16H14Cl2O2 — CID 2470853
(2,5-dimethylphenyl) 2-(3,4-dichlorophenyl)acetate (PubChem CID 2470853) has the molecular formula C16H14Cl2O2 and a molecular weight of 309.19 g/mol. Its IUPAC name is (2,5-dimethylphenyl) 2-(3,4-dichlorophenyl)acetate.
| Compound Name | (2,5-dimethylphenyl) 2-(3,4-dichlorophenyl)acetate |
|---|---|
| PubChem CID | 2470853 |
| Molecular Formula | C16H14Cl2O2 |
| Molecular Weight | 309.19 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | (2,5-dimethylphenyl) 2-(3,4-dichlorophenyl)acetate |
| SMILES | Cc1ccc(C)c(OC(=O)Cc2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C16H14Cl2O2/c1-10-3-4-11(2)15(7-10)20-16(19)9-12-5-6-13(17)14(18)8-12/h3-8H,9H2,1-2H3 |
| InChIKey | NNDRNVVYTVPOSW-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.19 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|