C14H9Cl3O3 — CID 15608392
(2,4,5-trichlorophenyl) 2-(4-hydroxyphenyl)acetate (PubChem CID 15608392) has the molecular formula C14H9Cl3O3 and a molecular weight of 331.58 g/mol. Its IUPAC name is (2,4,5-trichlorophenyl) 2-(4-hydroxyphenyl)acetate.
| Compound Name | (2,4,5-trichlorophenyl) 2-(4-hydroxyphenyl)acetate |
|---|---|
| PubChem CID | 15608392 |
| Molecular Formula | C14H9Cl3O3 |
| Molecular Weight | 331.58 g/mol |
| Exact Mass | 329.96 |
| IUPAC Name | (2,4,5-trichlorophenyl) 2-(4-hydroxyphenyl)acetate |
| SMILES | O=C(Cc1ccc(O)cc1)Oc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H9Cl3O3/c15-10-6-12(17)13(7-11(10)16)20-14(19)5-8-1-3-9(18)4-2-8/h1-4,6-7,18H,5H2 |
| InChIKey | PHRHZAQZYMGBMM-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.58 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|