C19H19Cl2NO3 — CID 7725051
[2-oxo-2-(2,4,6-trimethylanilino)ethyl] 2-(3,4-dichlorophenyl)acetate (PubChem CID 7725051) has the molecular formula C19H19Cl2NO3 and a molecular weight of 380.27 g/mol. Its IUPAC name is [2-oxo-2-(2,4,6-trimethylanilino)ethyl] 2-(3,4-dichlorophenyl)acetate.
| Compound Name | [2-oxo-2-(2,4,6-trimethylanilino)ethyl] 2-(3,4-dichlorophenyl)acetate |
|---|---|
| PubChem CID | 7725051 |
| Molecular Formula | C19H19Cl2NO3 |
| Molecular Weight | 380.27 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | [2-oxo-2-(2,4,6-trimethylanilino)ethyl] 2-(3,4-dichlorophenyl)acetate |
| SMILES | Cc1cc(C)c(NC(=O)COC(=O)Cc2ccc(Cl)c(Cl)c2)c(C)c1 |
| InChI | InChI=1S/C19H19Cl2NO3/c1-11-6-12(2)19(13(3)7-11)22-17(23)10-25-18(24)9-14-4-5-15(20)16(21)8-14/h4-8H,9-10H2,1-3H3,(H,22,23) |
| InChIKey | RACOANACAIGZPN-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.27 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |