C18H14Cl2N2O3 — CID 8871895
[2-[4-(cyanomethyl)anilino]-2-oxoethyl] 2-(3,4-dichlorophenyl)acetate (PubChem CID 8871895) has the molecular formula C18H14Cl2N2O3 and a molecular weight of 377.23 g/mol. Its IUPAC name is [2-[4-(cyanomethyl)anilino]-2-oxoethyl] 2-(3,4-dichlorophenyl)acetate.
| Compound Name | [2-[4-(cyanomethyl)anilino]-2-oxoethyl] 2-(3,4-dichlorophenyl)acetate |
|---|---|
| PubChem CID | 8871895 |
| Molecular Formula | C18H14Cl2N2O3 |
| Molecular Weight | 377.23 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | [2-[4-(cyanomethyl)anilino]-2-oxoethyl] 2-(3,4-dichlorophenyl)acetate |
| SMILES | N#CCc1ccc(NC(=O)COC(=O)Cc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C18H14Cl2N2O3/c19-15-6-3-13(9-16(15)20)10-18(24)25-11-17(23)22-14-4-1-12(2-5-14)7-8-21/h1-6,9H,7,10-11H2,(H,22,23) |
| InChIKey | MVVOZXOJJWBBQV-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.23 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |