C12H13Cl2NO3 — CID 2514718
[2-(ethylamino)-2-oxoethyl] 2-(3,4-dichlorophenyl)acetate (PubChem CID 2514718) has the molecular formula C12H13Cl2NO3 and a molecular weight of 290.15 g/mol. Its IUPAC name is [2-(ethylamino)-2-oxoethyl] 2-(3,4-dichlorophenyl)acetate.
| Compound Name | [2-(ethylamino)-2-oxoethyl] 2-(3,4-dichlorophenyl)acetate |
|---|---|
| PubChem CID | 2514718 |
| Molecular Formula | C12H13Cl2NO3 |
| Molecular Weight | 290.15 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | [2-(ethylamino)-2-oxoethyl] 2-(3,4-dichlorophenyl)acetate |
| SMILES | CCNC(=O)COC(=O)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H13Cl2NO3/c1-2-15-11(16)7-18-12(17)6-8-3-4-9(13)10(14)5-8/h3-5H,2,6-7H2,1H3,(H,15,16) |
| InChIKey | BROHDKISJVQRSA-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.15 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |