C23H22O5 — CID 7926501
(4-phenylphenyl) 2-(3,4,5-trimethoxyphenyl)acetate (PubChem CID 7926501) has the molecular formula C23H22O5 and a molecular weight of 378.42 g/mol. Its IUPAC name is (4-phenylphenyl) 2-(3,4,5-trimethoxyphenyl)acetate.
| Compound Name | (4-phenylphenyl) 2-(3,4,5-trimethoxyphenyl)acetate |
|---|---|
| PubChem CID | 7926501 |
| Molecular Formula | C23H22O5 |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | (4-phenylphenyl) 2-(3,4,5-trimethoxyphenyl)acetate |
| SMILES | COc1cc(CC(=O)Oc2ccc(-c3ccccc3)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C23H22O5/c1-25-20-13-16(14-21(26-2)23(20)27-3)15-22(24)28-19-11-9-18(10-12-19)17-7-5-4-6-8-17/h4-14H,15H2,1-3H3 |
| InChIKey | AWOOMHOLJBNWDA-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|