C18H18N4O5 — CID 7758660
[4-(tetrazol-1-yl)phenyl] 2-(3,4,5-trimethoxyphenyl)acetate (PubChem CID 7758660) has the molecular formula C18H18N4O5 and a molecular weight of 370.37 g/mol. Its IUPAC name is [4-(tetrazol-1-yl)phenyl] 2-(3,4,5-trimethoxyphenyl)acetate.
| Compound Name | [4-(tetrazol-1-yl)phenyl] 2-(3,4,5-trimethoxyphenyl)acetate |
|---|---|
| PubChem CID | 7758660 |
| Molecular Formula | C18H18N4O5 |
| Molecular Weight | 370.37 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | [4-(tetrazol-1-yl)phenyl] 2-(3,4,5-trimethoxyphenyl)acetate |
| SMILES | COc1cc(CC(=O)Oc2ccc(-n3cnnn3)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C18H18N4O5/c1-24-15-8-12(9-16(25-2)18(15)26-3)10-17(23)27-14-6-4-13(5-7-14)22-11-19-20-21-22/h4-9,11H,10H2,1-3H3 |
| InChIKey | RSMAOXLJDQGWNK-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 97.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.37 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|