C20H24O6 — CID 8867360
[4-(2-methoxyethyl)phenyl] 2-(3,4,5-trimethoxyphenyl)acetate (PubChem CID 8867360) has the molecular formula C20H24O6 and a molecular weight of 360.41 g/mol. Its IUPAC name is [4-(2-methoxyethyl)phenyl] 2-(3,4,5-trimethoxyphenyl)acetate.
| Compound Name | [4-(2-methoxyethyl)phenyl] 2-(3,4,5-trimethoxyphenyl)acetate |
|---|---|
| PubChem CID | 8867360 |
| Molecular Formula | C20H24O6 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | [4-(2-methoxyethyl)phenyl] 2-(3,4,5-trimethoxyphenyl)acetate |
| SMILES | COCCc1ccc(OC(=O)Cc2cc(OC)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C20H24O6/c1-22-10-9-14-5-7-16(8-6-14)26-19(21)13-15-11-17(23-2)20(25-4)18(12-15)24-3/h5-8,11-12H,9-10,13H2,1-4H3 |
| InChIKey | IIUDPENIXGBOPI-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|