C16H18ClNO4 — CID 19624482
3-chloro-2-[(3,4,5-trimethoxyphenyl)methoxy]aniline (PubChem CID 19624482) has the molecular formula C16H18ClNO4 and a molecular weight of 323.78 g/mol. Its IUPAC name is 3-chloro-2-[(3,4,5-trimethoxyphenyl)methoxy]aniline.
| Compound Name | 3-chloro-2-[(3,4,5-trimethoxyphenyl)methoxy]aniline |
|---|---|
| PubChem CID | 19624482 |
| Molecular Formula | C16H18ClNO4 |
| Molecular Weight | 323.78 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 3-chloro-2-[(3,4,5-trimethoxyphenyl)methoxy]aniline |
| SMILES | COc1cc(COc2c(N)cccc2Cl)cc(OC)c1OC |
| InChI | InChI=1S/C16H18ClNO4/c1-19-13-7-10(8-14(20-2)16(13)21-3)9-22-15-11(17)5-4-6-12(15)18/h4-8H,9,18H2,1-3H3 |
| InChIKey | VLACRESEBSZASH-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.78 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|