C17H18F3NO4 — CID 19627067
5-(trifluoromethyl)-2-[(3,4,5-trimethoxyphenyl)methoxy]aniline (PubChem CID 19627067) has the molecular formula C17H18F3NO4 and a molecular weight of 357.33 g/mol. Its IUPAC name is 5-(trifluoromethyl)-2-[(3,4,5-trimethoxyphenyl)methoxy]aniline.
| Compound Name | 5-(trifluoromethyl)-2-[(3,4,5-trimethoxyphenyl)methoxy]aniline |
|---|---|
| PubChem CID | 19627067 |
| Molecular Formula | C17H18F3NO4 |
| Molecular Weight | 357.33 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 5-(trifluoromethyl)-2-[(3,4,5-trimethoxyphenyl)methoxy]aniline |
| SMILES | COc1cc(COc2ccc(C(F)(F)F)cc2N)cc(OC)c1OC |
| InChI | InChI=1S/C17H18F3NO4/c1-22-14-6-10(7-15(23-2)16(14)24-3)9-25-13-5-4-11(8-12(13)21)17(18,19)20/h4-8H,9,21H2,1-3H3 |
| InChIKey | LAAICFLEQPNPRW-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.33 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|