C11H9F3N2OS — CID 82007498
2-(1,3-thiazol-2-ylmethoxy)-5-(trifluoromethyl)aniline (PubChem CID 82007498) has the molecular formula C11H9F3N2OS and a molecular weight of 274.27 g/mol. Its IUPAC name is 2-(1,3-thiazol-2-ylmethoxy)-5-(trifluoromethyl)aniline.
| Compound Name | 2-(1,3-thiazol-2-ylmethoxy)-5-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 82007498 |
| Molecular Formula | C11H9F3N2OS |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | 2-(1,3-thiazol-2-ylmethoxy)-5-(trifluoromethyl)aniline |
| SMILES | Nc1cc(C(F)(F)F)ccc1OCc1nccs1 |
| InChI | InChI=1S/C11H9F3N2OS/c12-11(13,14)7-1-2-9(8(15)5-7)17-6-10-16-3-4-18-10/h1-5H,6,15H2 |
| InChIKey | XZFMCVYBQYGIAY-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|