C11H12N2O2S — CID 102702487
4-methoxy-2-(1,3-thiazol-2-ylmethoxy)aniline (PubChem CID 102702487) has the molecular formula C11H12N2O2S and a molecular weight of 236.30 g/mol. Its IUPAC name is 4-methoxy-2-(1,3-thiazol-2-ylmethoxy)aniline.
| Compound Name | 4-methoxy-2-(1,3-thiazol-2-ylmethoxy)aniline |
|---|---|
| PubChem CID | 102702487 |
| Molecular Formula | C11H12N2O2S |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | 4-methoxy-2-(1,3-thiazol-2-ylmethoxy)aniline |
| SMILES | COc1ccc(N)c(OCc2nccs2)c1 |
| InChI | InChI=1S/C11H12N2O2S/c1-14-8-2-3-9(12)10(6-8)15-7-11-13-4-5-16-11/h2-6H,7,12H2,1H3 |
| InChIKey | QMNWFIGLHDVSIE-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|