C22H26O7 — CID 8013688
(5-acetyl-2-ethoxyphenyl)methyl 2-(3,4,5-trimethoxyphenyl)acetate (PubChem CID 8013688) has the molecular formula C22H26O7 and a molecular weight of 402.44 g/mol. Its IUPAC name is (5-acetyl-2-ethoxyphenyl)methyl 2-(3,4,5-trimethoxyphenyl)acetate.
| Compound Name | (5-acetyl-2-ethoxyphenyl)methyl 2-(3,4,5-trimethoxyphenyl)acetate |
|---|---|
| PubChem CID | 8013688 |
| Molecular Formula | C22H26O7 |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | (5-acetyl-2-ethoxyphenyl)methyl 2-(3,4,5-trimethoxyphenyl)acetate |
| SMILES | CCOc1ccc(C(C)=O)cc1COC(=O)Cc1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C22H26O7/c1-6-28-18-8-7-16(14(2)23)12-17(18)13-29-21(24)11-15-9-19(25-3)22(27-5)20(10-15)26-4/h7-10,12H,6,11,13H2,1-5H3 |
| InChIKey | GQOXFTYTKXNWKN-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |