C22H23ClN4O12 — CID 88625896
2-[carboxymethyl-[(4-chloro-2-nitrophenyl)methyl]amino]acetic acid;2-[carboxymethyl-[(3-nitrophenyl)methyl]amino]acetic acid (PubChem CID 88625896) has the molecular formula C22H23ClN4O12 and a molecular weight of 570.90 g/mol. Its IUPAC name is 2-[carboxymethyl-[(4-chloro-2-nitrophenyl)methyl]amino]acetic acid;2-[carboxymethyl-[(3-nitrophenyl)methyl]amino]acetic acid.
| Compound Name | 2-[carboxymethyl-[(4-chloro-2-nitrophenyl)methyl]amino]acetic acid;2-[carboxymethyl-[(3-nitrophenyl)methyl]amino]acetic acid |
|---|---|
| PubChem CID | 88625896 |
| Molecular Formula | C22H23ClN4O12 |
| Molecular Weight | 570.90 g/mol |
| Exact Mass | 570.10 |
| IUPAC Name | 2-[carboxymethyl-[(4-chloro-2-nitrophenyl)methyl]amino]acetic acid;2-[carboxymethyl-[(3-nitrophenyl)methyl]amino]acetic acid |
| SMILES | O=C(O)CN(CC(=O)O)Cc1ccc(Cl)cc1[N+](=O)[O-].O=C(O)CN(CC(=O)O)Cc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H11ClN2O6.C11H12N2O6/c12-8-2-1-7(9(3-8)14(19)20)4-13(5-10(15)16)6-11(17)18;14-10(15)6-12(7-11(16)17)5-8-2-1-3-9(4-8)13(18)19/h1-3H,4-6H2,(H,15,16)(H,17,18);1-4H,5-7H2,(H,14,15)(H,16,17) |
| InChIKey | VSOZFPSSJNUINZ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 241.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.90 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|