C20H14Cl2N2O3 — CID 19164974
2,4-dichloro-N-[(3-nitrophenyl)methyl]-N-phenylbenzamide (PubChem CID 19164974) has the molecular formula C20H14Cl2N2O3 and a molecular weight of 401.25 g/mol. Its IUPAC name is 2,4-dichloro-N-[(3-nitrophenyl)methyl]-N-phenylbenzamide.
| Compound Name | 2,4-dichloro-N-[(3-nitrophenyl)methyl]-N-phenylbenzamide |
|---|---|
| PubChem CID | 19164974 |
| Molecular Formula | C20H14Cl2N2O3 |
| Molecular Weight | 401.25 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | 2,4-dichloro-N-[(3-nitrophenyl)methyl]-N-phenylbenzamide |
| SMILES | O=C(c1ccc(Cl)cc1Cl)N(Cc1cccc([N+](=O)[O-])c1)c1ccccc1 |
| InChI | InChI=1S/C20H14Cl2N2O3/c21-15-9-10-18(19(22)12-15)20(25)23(16-6-2-1-3-7-16)13-14-5-4-8-17(11-14)24(26)27/h1-12H,13H2 |
| InChIKey | WBUWCWXJTFUDSO-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.25 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|