C25H24Cl2N2O2 — CID 46052531
N-benzyl-2,4-dichloro-N-[4-[2-oxo-2-(propylamino)ethyl]phenyl]benzamide (PubChem CID 46052531) has the molecular formula C25H24Cl2N2O2 and a molecular weight of 455.39 g/mol. Its IUPAC name is N-benzyl-2,4-dichloro-N-[4-[2-oxo-2-(propylamino)ethyl]phenyl]benzamide.
| Compound Name | N-benzyl-2,4-dichloro-N-[4-[2-oxo-2-(propylamino)ethyl]phenyl]benzamide |
|---|---|
| PubChem CID | 46052531 |
| Molecular Formula | C25H24Cl2N2O2 |
| Molecular Weight | 455.39 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | N-benzyl-2,4-dichloro-N-[4-[2-oxo-2-(propylamino)ethyl]phenyl]benzamide |
| SMILES | CCCNC(=O)Cc1ccc(N(Cc2ccccc2)C(=O)c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C25H24Cl2N2O2/c1-2-14-28-24(30)15-18-8-11-21(12-9-18)29(17-19-6-4-3-5-7-19)25(31)22-13-10-20(26)16-23(22)27/h3-13,16H,2,14-15,17H2,1H3,(H,28,30) |
| InChIKey | FUTDNZDJGNLMJO-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.39 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |