C30H27ClN2O2 — CID 92987150
N-benzyl-4-chloro-N-[4-[2-oxo-2-[[(1R)-1-phenylethyl]amino]ethyl]phenyl]benzamide (PubChem CID 92987150) has the molecular formula C30H27ClN2O2 and a molecular weight of 483.01 g/mol. Its IUPAC name is N-benzyl-4-chloro-N-[4-[2-oxo-2-[[(1R)-1-phenylethyl]amino]ethyl]phenyl]benzamide.
| Compound Name | N-benzyl-4-chloro-N-[4-[2-oxo-2-[[(1R)-1-phenylethyl]amino]ethyl]phenyl]benzamide |
|---|---|
| PubChem CID | 92987150 |
| Molecular Formula | C30H27ClN2O2 |
| Molecular Weight | 483.01 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | N-benzyl-4-chloro-N-[4-[2-oxo-2-[[(1R)-1-phenylethyl]amino]ethyl]phenyl]benzamide |
| SMILES | C[C@@H](NC(=O)Cc1ccc(N(Cc2ccccc2)C(=O)c2ccc(Cl)cc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C30H27ClN2O2/c1-22(25-10-6-3-7-11-25)32-29(34)20-23-12-18-28(19-13-23)33(21-24-8-4-2-5-9-24)30(35)26-14-16-27(31)17-15-26/h2-19,22H,20-21H2,1H3,(H,32,34)/t22-/m1/s1 |
| InChIKey | OKBMVVDREKESOY-JOCHJYFZSA-N |
| XLogP | 6.61 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.01 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |