C29H25ClN2O2 — CID 46045826
N-benzyl-N-[4-[2-(benzylamino)-2-oxoethyl]phenyl]-4-chlorobenzamide (PubChem CID 46045826) has the molecular formula C29H25ClN2O2 and a molecular weight of 468.98 g/mol. Its IUPAC name is N-benzyl-N-[4-[2-(benzylamino)-2-oxoethyl]phenyl]-4-chlorobenzamide.
| Compound Name | N-benzyl-N-[4-[2-(benzylamino)-2-oxoethyl]phenyl]-4-chlorobenzamide |
|---|---|
| PubChem CID | 46045826 |
| Molecular Formula | C29H25ClN2O2 |
| Molecular Weight | 468.98 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | N-benzyl-N-[4-[2-(benzylamino)-2-oxoethyl]phenyl]-4-chlorobenzamide |
| SMILES | O=C(Cc1ccc(N(Cc2ccccc2)C(=O)c2ccc(Cl)cc2)cc1)NCc1ccccc1 |
| InChI | InChI=1S/C29H25ClN2O2/c30-26-15-13-25(14-16-26)29(34)32(21-24-9-5-2-6-10-24)27-17-11-22(12-18-27)19-28(33)31-20-23-7-3-1-4-8-23/h1-18H,19-21H2,(H,31,33) |
| InChIKey | WXMPLJKFQCOMTJ-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.98 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |