C27H24N2O3 — CID 46045761
N-benzyl-N-[4-[2-(benzylamino)-2-oxoethyl]phenyl]furan-2-carboxamide (PubChem CID 46045761) has the molecular formula C27H24N2O3 and a molecular weight of 424.50 g/mol. Its IUPAC name is N-benzyl-N-[4-[2-(benzylamino)-2-oxoethyl]phenyl]furan-2-carboxamide.
| Compound Name | N-benzyl-N-[4-[2-(benzylamino)-2-oxoethyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 46045761 |
| Molecular Formula | C27H24N2O3 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | N-benzyl-N-[4-[2-(benzylamino)-2-oxoethyl]phenyl]furan-2-carboxamide |
| SMILES | O=C(Cc1ccc(N(Cc2ccccc2)C(=O)c2ccco2)cc1)NCc1ccccc1 |
| InChI | InChI=1S/C27H24N2O3/c30-26(28-19-22-8-3-1-4-9-22)18-21-13-15-24(16-14-21)29(20-23-10-5-2-6-11-23)27(31)25-12-7-17-32-25/h1-17H,18-20H2,(H,28,30) |
| InChIKey | XODKTOZFWXZGRG-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |