C31H30N2O2 — CID 46052536
N-benzyl-2-methyl-N-[4-[2-oxo-2-(1-phenylethylamino)ethyl]phenyl]benzamide (PubChem CID 46052536) has the molecular formula C31H30N2O2 and a molecular weight of 462.59 g/mol. Its IUPAC name is N-benzyl-2-methyl-N-[4-[2-oxo-2-(1-phenylethylamino)ethyl]phenyl]benzamide.
| Compound Name | N-benzyl-2-methyl-N-[4-[2-oxo-2-(1-phenylethylamino)ethyl]phenyl]benzamide |
|---|---|
| PubChem CID | 46052536 |
| Molecular Formula | C31H30N2O2 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | N-benzyl-2-methyl-N-[4-[2-oxo-2-(1-phenylethylamino)ethyl]phenyl]benzamide |
| SMILES | Cc1ccccc1C(=O)N(Cc1ccccc1)c1ccc(CC(=O)NC(C)c2ccccc2)cc1 |
| InChI | InChI=1S/C31H30N2O2/c1-23-11-9-10-16-29(23)31(35)33(22-26-12-5-3-6-13-26)28-19-17-25(18-20-28)21-30(34)32-24(2)27-14-7-4-8-15-27/h3-20,24H,21-22H2,1-2H3,(H,32,34) |
| InChIKey | BOTNMKMZCNZTSS-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |