C20H20ClN3O5 — CID 7279155
(2R)-2-(5-chloro-2-oxo-1-pyridinyl)-N-cyclohexyl-3-(3-nitrophenyl)-3-oxopropanamide (PubChem CID 7279155) has the molecular formula C20H20ClN3O5 and a molecular weight of 417.85 g/mol. Its IUPAC name is (2R)-2-(5-chloro-2-oxo-1-pyridinyl)-N-cyclohexyl-3-(3-nitrophenyl)-3-oxopropanamide.
| Compound Name | (2R)-2-(5-chloro-2-oxo-1-pyridinyl)-N-cyclohexyl-3-(3-nitrophenyl)-3-oxopropanamide |
|---|---|
| PubChem CID | 7279155 |
| Molecular Formula | C20H20ClN3O5 |
| Molecular Weight | 417.85 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | (2R)-2-(5-chloro-2-oxo-1-pyridinyl)-N-cyclohexyl-3-(3-nitrophenyl)-3-oxopropanamide |
| SMILES | O=C(NC1CCCCC1)[C@@H](C(=O)c1cccc([N+](=O)[O-])c1)n1cc(Cl)ccc1=O |
| InChI | InChI=1S/C20H20ClN3O5/c21-14-9-10-17(25)23(12-14)18(20(27)22-15-6-2-1-3-7-15)19(26)13-5-4-8-16(11-13)24(28)29/h4-5,8-12,15,18H,1-3,6-7H2,(H,22,27)/t18-/m1/s1 |
| InChIKey | CDWOQYBFMWFVAI-GOSISDBHSA-N |
| XLogP | 3.28 |
| TPSA | 111.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.85 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|