C25H28N4O6 — CID 3523746
N-cyclopentyl-1-[3-(3-nitrophenyl)-3-oxo-2-(2-oxo-1-pyridinyl)propanoyl]piperidine-4-carboxamide (PubChem CID 3523746) has the molecular formula C25H28N4O6 and a molecular weight of 480.52 g/mol. Its IUPAC name is N-cyclopentyl-1-[3-(3-nitrophenyl)-3-oxo-2-(2-oxo-1-pyridinyl)propanoyl]piperidine-4-carboxamide.
| Compound Name | N-cyclopentyl-1-[3-(3-nitrophenyl)-3-oxo-2-(2-oxo-1-pyridinyl)propanoyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 3523746 |
| Molecular Formula | C25H28N4O6 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | N-cyclopentyl-1-[3-(3-nitrophenyl)-3-oxo-2-(2-oxo-1-pyridinyl)propanoyl]piperidine-4-carboxamide |
| SMILES | O=C(NC1CCCC1)C1CCN(C(=O)C(C(=O)c2cccc([N+](=O)[O-])c2)n2ccccc2=O)CC1 |
| InChI | InChI=1S/C25H28N4O6/c30-21-10-3-4-13-28(21)22(23(31)18-6-5-9-20(16-18)29(34)35)25(33)27-14-11-17(12-15-27)24(32)26-19-7-1-2-8-19/h3-6,9-10,13,16-17,19,22H,1-2,7-8,11-12,14-15H2,(H,26,32) |
| InChIKey | VPQZYHIYIWMMTE-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 131.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|